EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:36106 - 2-naphthoic acid
| Formula | C11H8O2 |
| Net Charge | 0 |
| Average Mass | 172.183 |
| Monoisotopic Mass | 172.05243 |
| SMILES | O=C(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H8O2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,12,13) |
| InChIKey | UOBYKYZJUGYBDK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-naphthoic acid (CHEBI:36106) has role mouse metabolite (CHEBI:75771) |
| 2-naphthoic acid (CHEBI:36106) has role xenobiotic metabolite (CHEBI:76206) |
| 2-naphthoic acid (CHEBI:36106) is a naphthoic acid (CHEBI:25483) |
| 2-naphthoic acid (CHEBI:36106) is conjugate acid of 2-naphthoate (CHEBI:36107) |
| Incoming Relation(s) |
| 1-hydroxy-2-naphthoic acid (CHEBI:36108) has functional parent 2-naphthoic acid (CHEBI:36106) |
| 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) has functional parent 2-naphthoic acid (CHEBI:36106) |
| 2-naphthoyl-CoA (CHEBI:34300) has functional parent 2-naphthoic acid (CHEBI:36106) |
| 6-dimethylamino-2-naphthoic acid (CHEBI:51912) has functional parent 2-naphthoic acid (CHEBI:36106) |
| pamoic acid (CHEBI:50186) has functional parent 2-naphthoic acid (CHEBI:36106) |
| 2-naphthoate (CHEBI:36107) is conjugate base of 2-naphthoic acid (CHEBI:36106) |
| 2-naphthoyl group (CHEBI:52675) is substituent group from 2-naphthoic acid (CHEBI:36106) |
| IUPAC Name |
|---|
| naphthalene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-naphthalenecarboxylic acid | ChemIDplus |
| 2-Naphthalenecarboxylic acid | KEGG COMPOUND |
| 2-Naphthoic acid | KEGG COMPOUND |
| beta-Naphthoic acid | KEGG COMPOUND |
| isonaphthoic acid | ChemIDplus |
| β-naphthoic acid | ChemIDplus |
| Citations |
|---|