EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H7O2 |
| Net Charge | -1 |
| Average Mass | 171.175 |
| Monoisotopic Mass | 171.04515 |
| SMILES | O=C([O-])c1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H8O2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,12,13)/p-1 |
| InChIKey | UOBYKYZJUGYBDK-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-naphthoate (CHEBI:36107) has role xenobiotic metabolite (CHEBI:76206) |
| 2-naphthoate (CHEBI:36107) is a naphthoate (CHEBI:25482) |
| 2-naphthoate (CHEBI:36107) is conjugate base of 2-naphthoic acid (CHEBI:36106) |
| Incoming Relation(s) |
| 1-hydroxy-2-naphthoate (CHEBI:15992) has functional parent 2-naphthoate (CHEBI:36107) |
| 1,4-dihydroxy-2-naphthoate (CHEBI:11173) has functional parent 2-naphthoate (CHEBI:36107) |
| 2-naphthoic acid (CHEBI:36106) is conjugate acid of 2-naphthoate (CHEBI:36107) |
| IUPAC Name |
|---|
| naphthalene-2-carboxylate |
| Synonym | Source |
|---|---|
| 2-naphthoate(1−) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:329643 | Gmelin |
| Beilstein:3905271 | Beilstein |
| Reaxys:3905271 | Reaxys |