EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H16O6 |
| Net Charge | 0 |
| Average Mass | 388.375 |
| Monoisotopic Mass | 388.09469 |
| SMILES | O=C(O)c1cc2ccccc2c(Cc2c(O)c(C(=O)O)cc3ccccc23)c1O |
| InChI | InChI=1S/C23H16O6/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29/h1-10,24-25H,11H2,(H,26,27)(H,28,29) |
| InChIKey | WLJNZVDCPSBLRP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pamoic acid (CHEBI:50186) has functional parent 2-naphthoic acid (CHEBI:36106) |
| pamoic acid (CHEBI:50186) is a dicarboxylic acid (CHEBI:35692) |
| pamoic acid (CHEBI:50186) is conjugate acid of pamoate(2−) (CHEBI:50187) |
| Incoming Relation(s) |
| pamoate(2−) (CHEBI:50187) is conjugate base of pamoic acid (CHEBI:50186) |
| IUPAC Name |
|---|
| 4,4'-methylenebis(3-hydroxynaphthalene-2-carboxylic acid) |
| Synonyms | Source |
|---|---|
| 4,4'-Methylen-bis-(3-hydroxy-2-naphthoesäure) | ChemIDplus |
| 4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) | ChemIDplus |
| Embonic acid | ChemIDplus |
| Pamosäure | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:901319 | Beilstein |
| CAS:130-85-8 | ChemIDplus |