EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:36108 - 1-hydroxy-2-naphthoic acid
| Formula | C11H8O3 |
| Net Charge | 0 |
| Average Mass | 188.182 |
| Monoisotopic Mass | 188.04734 |
| SMILES | O=C(O)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C11H8O3/c12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h1-6,12H,(H,13,14) |
| InChIKey | SJJCQDRGABAVBB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. fungal xenobiotic metabolite Any fungal metabolite produced by metabolism of a xenobiotic compound in fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-hydroxy-2-naphthoic acid (CHEBI:36108) has functional parent 2-naphthoic acid (CHEBI:36106) |
| 1-hydroxy-2-naphthoic acid (CHEBI:36108) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 1-hydroxy-2-naphthoic acid (CHEBI:36108) has role fungal xenobiotic metabolite (CHEBI:76968) |
| 1-hydroxy-2-naphthoic acid (CHEBI:36108) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 1-hydroxy-2-naphthoic acid (CHEBI:36108) is a naphthoic acid (CHEBI:25483) |
| 1-hydroxy-2-naphthoic acid (CHEBI:36108) is a naphthols (CHEBI:25392) |
| 1-hydroxy-2-naphthoic acid (CHEBI:36108) is conjugate acid of 1-hydroxy-2-naphthoate (CHEBI:15992) |
| Incoming Relation(s) |
| 1-hydroxy-2-naphthoate (CHEBI:15992) is conjugate base of 1-hydroxy-2-naphthoic acid (CHEBI:36108) |
| IUPAC Name |
|---|
| 1-hydroxynaphthalene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1-Hydroxy-2-naphthoic acid | KEGG COMPOUND |
| 1-Naphthol-2-carboxylic acid | KEGG COMPOUND |
| 1-hydroxy-2-naphthalenecarboxylic acid | ChemIDplus |
| 2-carboxy-1-naphthol | ChemIDplus |
| Citations |
|---|