EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O4 |
| Net Charge | 0 |
| Average Mass | 204.181 |
| Monoisotopic Mass | 204.04226 |
| SMILES | O=C(O)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C11H8O4/c12-9-5-8(11(14)15)10(13)7-4-2-1-3-6(7)9/h1-5,12-13H,(H,14,15) |
| InChIKey | VOJUXHHACRXLTD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (1091286) | ||
| - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) has functional parent 2-naphthoic acid (CHEBI:36106) |
| 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) has role Escherichia coli metabolite (CHEBI:76971) |
| 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) is a naphthalenediols (CHEBI:23783) |
| 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) is a naphthohydroquinone (CHEBI:51475) |
| 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) is a naphthoic acid (CHEBI:25483) |
| 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) is conjugate acid of 1,4-dihydroxy-2-naphthoate (CHEBI:11173) |
| Incoming Relation(s) |
| 1,4-dihydroxy-2-naphthoyl-CoA (CHEBI:52668) has functional parent 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) |
| 1,4-dihydroxy-2-naphthoate (CHEBI:11173) is conjugate base of 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) |
| IUPAC Name |
|---|
| 1,4-dihydroxynaphthalene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1,4-Dihydroxy-2-naphthalenecarboxylic acid | ChemIDplus |
| 1,4-Dihydroxy-2-naphthoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000736 | KNApSAcK |
| C03657 | KEGG COMPOUND |
| ECMDB04054 | ECMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2111226 | Reaxys |
| CAS:31519-22-9 | KEGG COMPOUND |
| CAS:31519-22-9 | ChemIDplus |
| Citations |
|---|