EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H]C(=CCCC([H])=CCCCCC)C=C([H])C=C([H])CCCCC(=O)O |
| InChI | InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,10-15H,2-5,8-9,16-19H2,1H3,(H,21,22) |
| InChIKey | RUDAIQLQFUMSCE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) is a icosatetraenoic acid (CHEBI:36033) |
| Incoming Relation(s) |
| 12-epi-leukotriene B4 (CHEBI:72795) has functional parent icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) |
| 12-dehydro-leukotriene B4 (CHEBI:27814) has functional parent icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) |
| 12-oxo-6-trans-leukotriene B4 (CHEBI:136597) has functional parent icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) |
| 20-oxoleukotriene B4 (CHEBI:63979) has functional parent icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) |
| 6-trans-leukotriene B4 (CHEBI:63981) has functional parent icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) |
| leukotriene B4 (CHEBI:15647) has functional parent icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) |
| Δ6-trans-12-epi-leukotriene B4 (CHEBI:63982) has functional parent icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) |
| Δ6-trans,Δ8-cis-leukotriene B4 (CHEBI:53027) has functional parent icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) |
| IUPAC Name |
|---|
| icosa-6,8,10,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 6,8,10,14-18:4 | ChEBI |
| 6,8,10,14-eicosatetraenoic acid | ChEBI |
| 6,8,10,14-eicosatetraenoic acids | ChEBI |
| 6,8,10,14-icosatetraenoic acid | ChEBI |
| 6,8,10,14-icosatetraenoic acids | ChEBI |
| C18:4, n-6,10,12,14 | ChEBI |