EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | CCCCC/C=C\CC(=O)/C=C/C=C/C=C/[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-11,14-15,19,22H,2-5,12-13,16-17H2,1H3,(H,23,24)/b8-7+,9-6-,14-10+,15-11+/t19-/m1/s1 |
| InChIKey | SJVWVCVZWMJXOK-TWMXWPQVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-oxo-6-trans-leukotriene B4 (CHEBI:136597) has functional parent icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) |
| 12-oxo-6-trans-leukotriene B4 (CHEBI:136597) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 12-oxo-6-trans-leukotriene B4 (CHEBI:136597) is a leukotriene (CHEBI:25029) |
| 12-oxo-6-trans-leukotriene B4 (CHEBI:136597) is a long-chain fatty acid (CHEBI:15904) |
| 12-oxo-6-trans-leukotriene B4 (CHEBI:136597) is a oxo fatty acid (CHEBI:59644) |
| 12-oxo-6-trans-leukotriene B4 (CHEBI:136597) is conjugate acid of 12-oxo-6-trans-leukotriene B4(1−) (CHEBI:133974) |
| Incoming Relation(s) |
| 12-oxo-6-trans-leukotriene B4(1−) (CHEBI:133974) is conjugate base of 12-oxo-6-trans-leukotriene B4 (CHEBI:136597) |
| IUPAC Name |
|---|
| (5S,6E,8E,10E,14Z)-5-hydroxy-12-oxoicosa-6,8,10,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 12-dehydro-6-trans-leukotriene B4 | ChEBI |
| 12-keto-(5S)-hydroxy-(6E,8E,10E,14Z)-icosatetraenoic acid | ChEBI |
| 12-keto-6-trans-leukotriene B4 | ChEBI |
| 12-oxo-(5S)-hydroxy-(6E,8E,10E,14Z)-eicosatetraenoic acid | ChEBI |
| 12-oxo-6-trans-LTB4 | ChEBI |
| (5S,6E,8E,10E,14Z)-5-hydroxy-12-oxoicosatetraenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7253021 | Reaxys |