EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCC/C=C\C[C@@H](O)/C=C/C=C\C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-11,14-15,18-19,21-22H,2-5,12-13,16-17H2,1H3,(H,23,24)/b8-7-,9-6-,14-10+,15-11+/t18-,19-/m1/s1 |
| InChIKey | VNYSSYRCGWBHLG-GEWAPNICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Δ6-trans,Δ8-cis-leukotriene B4 (CHEBI:53027) has functional parent icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) |
| Δ6-trans,Δ8-cis-leukotriene B4 (CHEBI:53027) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| Δ6-trans,Δ8-cis-leukotriene B4 (CHEBI:53027) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| Δ6-trans,Δ8-cis-leukotriene B4 (CHEBI:53027) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| Δ6-trans,Δ8-cis-leukotriene B4 (CHEBI:53027) is a leukotriene (CHEBI:25029) |
| Δ6-trans,Δ8-cis-leukotriene B4 (CHEBI:53027) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (5S,6E,8Z,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| (5S,12R,6E,8Z,10E,14Z)-5,12-dihydroxy-6,8,10,14-eicosatetraenoic acid | ChEBI |
| 5(S),12(R)-dihydroxy-6(E),8(Z),10(E),14(Z)-eicosatetraenoic acid | ChEBI |
| 5(S),12(R)-dihydroxy-6(E),8(Z),10(E),14(Z)-icosatetraenoic acid | ChEBI |
| (5S,6E,8Z,10E,12R,14Z)-5,12-dihydroxyeicosa-6,8,10,14-tetraenoic acid | ChEBI |
| (6E,8Z)-LTB4 | ChEBI |
| (6E,8Z)-LTB4 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8442969 | Beilstein |