EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | O=CCCCC/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O5/c21-17-10-6-2-1-3-7-12-18(22)13-8-4-5-9-14-19(23)15-11-16-20(24)25/h3-5,7-9,13-14,17-19,22-23H,1-2,6,10-12,15-16H2,(H,24,25)/b5-4+,7-3-,13-8+,14-9-/t18-,19-/m1/s1 |
| InChIKey | LVLQYGYNBVIONY-PSPARDEHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-oxoleukotriene B4 (CHEBI:63979) has functional parent icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) |
| 20-oxoleukotriene B4 (CHEBI:63979) has role metabolite (CHEBI:25212) |
| 20-oxoleukotriene B4 (CHEBI:63979) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 20-oxoleukotriene B4 (CHEBI:63979) is a hydroxyaldehyde (CHEBI:50413) |
| 20-oxoleukotriene B4 (CHEBI:63979) is a leukotriene (CHEBI:25029) |
| 20-oxoleukotriene B4 (CHEBI:63979) is a long-chain fatty acid (CHEBI:15904) |
| 20-oxoleukotriene B4 (CHEBI:63979) is a polyunsaturated fatty acid (CHEBI:26208) |
| 20-oxoleukotriene B4 (CHEBI:63979) is a ω-oxo fatty acid (CHEBI:76328) |
| 20-oxoleukotriene B4 (CHEBI:63979) is conjugate acid of 20-oxoleukotriene B4(1−) (CHEBI:90720) |
| Incoming Relation(s) |
| 20-oxoleukotriene B4(1−) (CHEBI:90720) is conjugate base of 20-oxoleukotriene B4 (CHEBI:63979) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxy-20-oxoicosa-6,8,10,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 20-Aldehyde leukotriene B4 | ChemIDplus |
| 20cho-LTB4 | SUBMITTER |
| 20-OXO-LTB4 | SUBMITTER |
| Leukotriene B4-20-aldehyde | ChemIDplus |
| Ltb4-20-aldehyde | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:115609-68-2 | ChemIDplus |
| Citations |
|---|