EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCC/C=C\C[C@H](O)/C=C/C=C/C=C/[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-11,14-15,18-19,21-22H,2-5,12-13,16-17H2,1H3,(H,23,24)/b8-7+,9-6-,14-10+,15-11+/t18-,19+/m0/s1 |
| InChIKey | VNYSSYRCGWBHLG-CTOJTRLNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Δ6-trans-12-epi-leukotriene B4 (CHEBI:63982) has functional parent icosa-6,8,10,14-tetraenoic acid (CHEBI:36045) |
| Δ6-trans-12-epi-leukotriene B4 (CHEBI:63982) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| Δ6-trans-12-epi-leukotriene B4 (CHEBI:63982) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| Δ6-trans-12-epi-leukotriene B4 (CHEBI:63982) is a leukotriene (CHEBI:25029) |
| Δ6-trans-12-epi-leukotriene B4 (CHEBI:63982) is a long-chain fatty acid (CHEBI:15904) |
| Δ6-trans-12-epi-leukotriene B4 (CHEBI:63982) is conjugate acid of Δ6-trans-12-epi-leukotriene B4(1−) (CHEBI:133975) |
| Incoming Relation(s) |
| Δ6-trans-12-epi-leukotriene B4(1−) (CHEBI:133975) is conjugate base of Δ6-trans-12-epi-leukotriene B4 (CHEBI:63982) |
| IUPAC Name |
|---|
| (5S,6E,8E,10E,12S,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 6-trans-12-epi-LTB4 | SUBMITTER |
| 5S,12S-dihydroxy-6E,8E,10E,14Z-eicosatetraenoic acid | LIPID MAPS |
| 6-trans-12-epi-Leukotriene B4 | LIPID MAPS |
| 12-epi-Δ6-trans-leukotriene B4 | HMDB |
| 5(S),12(S)-Dihydroxy-6,8,10,14-(trans,trans,trans,cis)-eicosatetraenoic acid | HMDB |
| (5S,6E,8E,10E,12S,14Z)-5,12-dihydroxyeicosa-6,8,10,14-tetraenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA03020014 | LIPID MAPS |
| HMDB0005088 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4696047 | Reaxys |
| CAS:71548-19-1 | HMDB |