EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 |
| InChIKey | QWCKQJZIFLGMSD-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-α-aminobutyric acid (CHEBI:35619) has role human metabolite (CHEBI:77746) |
| L-α-aminobutyric acid (CHEBI:35619) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-α-aminobutyric acid (CHEBI:35619) is a α-aminobutyric acid (CHEBI:35621) |
| L-α-aminobutyric acid (CHEBI:35619) is conjugate acid of L-2-aminobutyrate (CHEBI:28340) |
| L-α-aminobutyric acid (CHEBI:35619) is enantiomer of D-α-aminobutyric acid (CHEBI:28797) |
| L-α-aminobutyric acid (CHEBI:35619) is tautomer of L-α-aminobutyrate zwitterion (CHEBI:74359) |
| Incoming Relation(s) |
| N-[(2S)-2-aminobutanoyl]glycine (CHEBI:144728) has functional parent L-α-aminobutyric acid (CHEBI:35619) |
| L-2-amino-4-methoxy-cis-but-3-enoic acid (CHEBI:40719) has functional parent L-α-aminobutyric acid (CHEBI:35619) |
| L-2-amino-4-methoxy-trans-but-3-enoic acid (CHEBI:156361) has functional parent L-α-aminobutyric acid (CHEBI:35619) |
| brivaracetam (CHEBI:133013) has functional parent L-α-aminobutyric acid (CHEBI:35619) |
| L-2-aminobutyrate (CHEBI:28340) is conjugate base of L-α-aminobutyric acid (CHEBI:35619) |
| D-α-aminobutyric acid (CHEBI:28797) is enantiomer of L-α-aminobutyric acid (CHEBI:35619) |
| L-α-aminobutyric acid residue (CHEBI:40545) is substituent group from L-α-aminobutyric acid (CHEBI:35619) |
| L-α-aminobutyrate zwitterion (CHEBI:74359) is tautomer of L-α-aminobutyric acid (CHEBI:35619) |
| IUPAC Name |
|---|
| (2S)-2-aminobutanoic acid |
| Synonyms | Source |
|---|---|
| (−)-2-aminobutyric acid | ChemIDplus |
| (2S)-2-aminobutyric acid | ChEBI |
| (S)-2-Aminobutanoate | KEGG COMPOUND |
| (S)-2-Aminobutanoic acid | KEGG COMPOUND |
| (S)-2-Aminobutyric acid | KEGG COMPOUND |
| S-Butyrine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| AA0409 | RESID |
| ABA | PDBeChem |
| C02356 | KEGG COMPOUND |
| CPD0-1942 | MetaCyc |
| HMDB0000452 | HMDB |
| LMFA01100034 | LIPID MAPS |
| YMDB01570 | YMDB |
| Citations |
|---|