EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O3 |
| Net Charge | 0 |
| Average Mass | 160.173 |
| Monoisotopic Mass | 160.08479 |
| SMILES | CC[C@H](N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C6H12N2O3/c1-2-4(7)6(11)8-3-5(9)10/h4H,2-3,7H2,1H3,(H,8,11)(H,9,10)/t4-/m0/s1 |
| InChIKey | SVHUWZOIWWJJJM-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(2S)-2-aminobutanoyl]glycine (CHEBI:144728) has functional parent L-α-aminobutyric acid (CHEBI:35619) |
| N-[(2S)-2-aminobutanoyl]glycine (CHEBI:144728) is a carboxylic acid (CHEBI:33575) |
| N-[(2S)-2-aminobutanoyl]glycine (CHEBI:144728) is a dipeptide (CHEBI:46761) |
| N-[(2S)-2-aminobutanoyl]glycine (CHEBI:144728) is a glycine derivative (CHEBI:24373) |
| N-[(2S)-2-aminobutanoyl]glycine (CHEBI:144728) is a primary amino compound (CHEBI:50994) |
| N-[(2S)-2-aminobutanoyl]glycine (CHEBI:144728) is a secondary carboxamide (CHEBI:140325) |
| N-[(2S)-2-aminobutanoyl]glycine (CHEBI:144728) is tautomer of N-[(2S)-2-ammoniobutanoyl]glycinate (CHEBI:144699) |
| Incoming Relation(s) |
| N-[(2S)-2-ammoniobutanoyl]glycinate (CHEBI:144699) is tautomer of N-[(2S)-2-aminobutanoyl]glycine (CHEBI:144728) |
| IUPAC Names |
|---|
| N-[(2S)-2-aminobutanoyl]glycine |
| N-(L-α-aminobutanoyl)glycine |
| Synonyms | Source |
|---|---|
| {[(2S)-2-aminobutanoyl]amino}acetic acid | IUPAC |
| H-Abu-Gly-OH | ChEBI |
| 2-[(2S)-2-aminobutanamido]acetic acid | ChEBI |
| Citations |
|---|