EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28797 - D-α-aminobutyric acid
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | CC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m1/s1 |
| InChIKey | QWCKQJZIFLGMSD-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-α-aminobutyric acid (CHEBI:28797) is a D-α-amino acid (CHEBI:16733) |
| D-α-aminobutyric acid (CHEBI:28797) is a α-aminobutyric acid (CHEBI:35621) |
| D-α-aminobutyric acid (CHEBI:28797) is enantiomer of L-α-aminobutyric acid (CHEBI:35619) |
| Incoming Relation(s) |
| L-α-aminobutyric acid (CHEBI:35619) is enantiomer of D-α-aminobutyric acid (CHEBI:28797) |
| D-α-aminobutyric acid residue (CHEBI:40550) is substituent group from D-α-aminobutyric acid (CHEBI:28797) |
| IUPAC Name |
|---|
| (2R)-2-aminobutanoic acid |
| Synonyms | Source |
|---|---|
| (2R)-2-aminobutyric acid | ChEBI |
| alpha-aminobutyric acid | PDBeChem |
| D-2-Aminobutanoic acid | KEGG COMPOUND |
| D-2-Aminobutyrate | KEGG COMPOUND |
| D-2-Aminobutyric acid | KEGG COMPOUND |
| (R)-2-aminobutyric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02261 | KEGG COMPOUND |
| CPD0-1952 | MetaCyc |
| DB04454 | DrugBank |
| DBB | PDBeChem |
| HMDB0000650 | HMDB |
| LMFA01100043 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720934 | Reaxys |
| Gmelin:984641 | Gmelin |
| CAS:2623-91-8 | KEGG COMPOUND |
| CAS:2623-91-8 | ChemIDplus |
| Citations |
|---|