EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:35621 - α-aminobutyric acid
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | CCC(N)C(=O)O |
| InChI | InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7) |
| InChIKey | QWCKQJZIFLGMSD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-aminobutyric acid (CHEBI:35621) has functional parent butyric acid (CHEBI:30772) |
| α-aminobutyric acid (CHEBI:35621) has role human metabolite (CHEBI:77746) |
| α-aminobutyric acid (CHEBI:35621) is a monocarboxylic acid (CHEBI:25384) |
| α-aminobutyric acid (CHEBI:35621) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| α-aminobutyric acid (CHEBI:35621) is conjugate acid of α-aminobutyrate (CHEBI:86508) |
| Incoming Relation(s) |
| D-α-aminobutyric acid (CHEBI:28797) is a α-aminobutyric acid (CHEBI:35621) |
| L-α-aminobutyric acid (CHEBI:35619) is a α-aminobutyric acid (CHEBI:35621) |
| α-aminobutyrate (CHEBI:86508) is conjugate base of α-aminobutyric acid (CHEBI:35621) |
| IUPAC Name |
|---|
| 2-aminobutanoic acid |
| Synonyms | Source |
|---|---|
| butyrine | ChemIDplus |
| 2-aminobutyric acid | ChemIDplus |
| α-amino-n-butyric acid | NIST Chemistry WebBook |
| α-aminobutyric acid | NIST Chemistry WebBook |
| AABA | NIST Chemistry WebBook |
| 2-amino-n-butyric acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| CPD-3686 | MetaCyc |
| Alpha-Aminobutyric_acid | Wikipedia |
| DB04454 | DrugBank |
| Citations |
|---|