EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N2O2 |
| Net Charge | 0 |
| Average Mass | 212.293 |
| Monoisotopic Mass | 212.15248 |
| SMILES | CCC[C@@H]1CC(=O)N([C@@H](CC)C(N)=O)C1 |
| InChI | InChI=1S/C11H20N2O2/c1-3-5-8-6-10(14)13(7-8)9(4-2)11(12)15/h8-9H,3-7H2,1-2H3,(H2,12,15)/t8-,9+/m1/s1 |
| InChIKey | MSYKRHVOOPPJKU-BDAKNGLRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brivaracetam (CHEBI:133013) has functional parent L-α-aminobutyric acid (CHEBI:35619) |
| brivaracetam (CHEBI:133013) has role anticonvulsant (CHEBI:35623) |
| brivaracetam (CHEBI:133013) has role antineoplastic agent (CHEBI:35610) |
| brivaracetam (CHEBI:133013) is a non-proteinogenic amino acid derivative (CHEBI:83812) |
| brivaracetam (CHEBI:133013) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| (2S)-2-[(4R)-2-oxo-4-propylpyrrolidin-1-yl]butanamide |
| INN | Source |
|---|---|
| brivaracetam | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 2-(2-Oxo-4-propylpyrrolidin-1-yl)butanamide | ChemIDplus |
| UCB 34714 | ChemIDplus |
| UCB34714 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Briviact | ChemIDplus |
| Briviact (in italy: nubriveo) | ChEMBL |
| Briviact (in italy: nubriveo) | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 5068 | DrugCentral |
| Brivaracetam | Wikipedia |
| D08879 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9629290 | Reaxys |
| CAS:357336-20-0 | ChemIDplus |
| CAS:357336-20-0 | KEGG DRUG |
| Citations |
|---|