EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:32600 - tetracene
| Formula | C18H12 |
| Net Charge | 0 |
| Average Mass | 228.294 |
| Monoisotopic Mass | 228.09390 |
| SMILES | c1ccc2cc3cc4ccccc4cc3cc2c1 |
| InChI | InChI=1S/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
| InChIKey | IFLREYGFSNHWGE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetracene (CHEBI:32600) is a acene (CHEBI:35297) |
| tetracene (CHEBI:32600) is a tetracenes (CHEBI:51270) |
| Incoming Relation(s) |
| (13R)-13-dihydrocarminomycin (CHEBI:31058) has parent hydride tetracene (CHEBI:32600) |
| 13-deoxycarminomycin (CHEBI:31056) has parent hydride tetracene (CHEBI:32600) |
| 13-deoxydaunorubicin (CHEBI:31057) has parent hydride tetracene (CHEBI:32600) |
| 13-dihydrodaunorubicin (CHEBI:31059) has parent hydride tetracene (CHEBI:32600) |
| carminomycin (CHEBI:31359) has parent hydride tetracene (CHEBI:32600) |
| daunorubicin (CHEBI:41977) has parent hydride tetracene (CHEBI:32600) |
| doxorubicin (CHEBI:28748) has parent hydride tetracene (CHEBI:32600) |
| doxorubicinol (CHEBI:133817) has parent hydride tetracene (CHEBI:32600) |
| idarubicin (CHEBI:42068) has parent hydride tetracene (CHEBI:32600) |
| tetracenecarboxylate ester (CHEBI:48147) has parent hydride tetracene (CHEBI:32600) |
| tetracyclines (CHEBI:26895) has parent hydride tetracene (CHEBI:32600) |
| IUPAC Name |
|---|
| tetracene |
| Synonyms | Source |
|---|---|
| 2,3-benzanthracene | NIST Chemistry WebBook |
| benz[b]anthracene | NIST Chemistry WebBook |
| naphthacene | IUPAC |
| Citations |
|---|