EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C4H2)n.C10H8 |
| Net Charge | 0 |
| Average Mass | 178.234 |
| Monoisotopic Mass | 178.07825 |
| SMILES | c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H |
| InChIKey | MWPLVEDNUUSJAV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acene (CHEBI:35297) is a ortho-fused polycyclic arene (CHEBI:35296) |
| acene (CHEBI:35297) is a acenes (CHEBI:51269) |
| Incoming Relation(s) |
| anthracene (CHEBI:35298) is a acene (CHEBI:35297) |
| heptacene (CHEBI:33156) is a acene (CHEBI:35297) |
| hexacene (CHEBI:33152) is a acene (CHEBI:35297) |
| nonacene (CHEBI:33170) is a acene (CHEBI:35297) |
| octacene (CHEBI:33165) is a acene (CHEBI:35297) |
| pentacene (CHEBI:33148) is a acene (CHEBI:35297) |
| tetracene (CHEBI:32600) is a acene (CHEBI:35297) |
| IUPAC Name |
|---|
| acenes |
| Synonyms | Source |
|---|---|
| Acen | ChEBI |
| acene | IUPAC |
| acène | IUPAC |
| Azen | ChEBI |
| polyacenes | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Acene | Wikipedia |