EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31NO11 |
| Net Charge | 0 |
| Average Mass | 545.541 |
| Monoisotopic Mass | 545.18971 |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)([C@@H](O)CO)C[C@@H]3O[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C27H31NO11/c1-10-22(31)13(28)6-17(38-10)39-15-8-27(36,16(30)9-29)7-12-19(15)26(35)21-20(24(12)33)23(32)11-4-3-5-14(37-2)18(11)25(21)34/h3-5,10,13,15-17,22,29-31,33,35-36H,6-9,28H2,1-2H3/t10-,13-,15-,16-,17-,22+,27-/m0/s1 |
| InChIKey | NKZRZOVSJNSBFR-FEMMEMONSA-N |
| Roles Classification |
|---|
| Biological Roles: | cardiotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the heart and cardiomyocytes. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxorubicinol (CHEBI:133817) has parent hydride tetracene (CHEBI:32600) |
| doxorubicinol (CHEBI:133817) has role cardiotoxic agent (CHEBI:50912) |
| doxorubicinol (CHEBI:133817) has role drug metabolite (CHEBI:49103) |
| doxorubicinol (CHEBI:133817) is a p-quinones (CHEBI:25830) |
| doxorubicinol (CHEBI:133817) is a aminoglycoside (CHEBI:47779) |
| doxorubicinol (CHEBI:133817) is a anthracycline antibiotic (CHEBI:49322) |
| doxorubicinol (CHEBI:133817) is a aromatic ether (CHEBI:35618) |
| doxorubicinol (CHEBI:133817) is a deoxy hexoside (CHEBI:35315) |
| doxorubicinol (CHEBI:133817) is a phenols (CHEBI:33853) |
| doxorubicinol (CHEBI:133817) is a polyol (CHEBI:26191) |
| doxorubicinol (CHEBI:133817) is a tetracenequinones (CHEBI:51286) |
| IUPAC Name |
|---|
| (1S,3S)-3-[(1S)-1,2-dihydroxyethyl]-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxy-α-L-lyxo-hexopyranoside |
| Synonyms | Source |
|---|---|
| 13-dihydrodoxorubicin | SUBMITTER |
| adriamycinol | SUBMITTER |
| Antibiotic 27706RP | ChemIDplus |
| DOXOL | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041884 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6773847 | Reaxys |
| CAS:54193-28-1 | ChemIDplus |
| Citations |
|---|