EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31NO9 |
| Net Charge | 0 |
| Average Mass | 513.543 |
| Monoisotopic Mass | 513.19988 |
| SMILES | CC[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](O[C@H]2C[C@H](N)[C@H](O)[C@H](C)O2)C1)C(=O)c1c(OC)cccc1C3=O |
| InChI | InChI=1S/C27H31NO9/c1-4-27(34)9-13-19(16(10-27)37-17-8-14(28)22(29)11(2)36-17)26(33)21-20(24(13)31)23(30)12-6-5-7-15(35-3)18(12)25(21)32/h5-7,11,14,16-17,22,29,31,33-34H,4,8-10,28H2,1-3H3/t11-,14-,16-,17-,22+,27-/m0/s1 |
| InChIKey | XAMIMZAWZUSOPA-JIGXQNLBSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-deoxydaunorubicin (CHEBI:31057) has parent hydride tetracene (CHEBI:32600) |
| 13-deoxydaunorubicin (CHEBI:31057) is a p-quinones (CHEBI:25830) |
| 13-deoxydaunorubicin (CHEBI:31057) is a aminoglycoside antibiotic (CHEBI:22507) |
| 13-deoxydaunorubicin (CHEBI:31057) is a anthracycline (CHEBI:48120) |
| 13-deoxydaunorubicin (CHEBI:31057) is a deoxy hexoside (CHEBI:35315) |
| 13-deoxydaunorubicin (CHEBI:31057) is a monosaccharide derivative (CHEBI:63367) |
| 13-deoxydaunorubicin (CHEBI:31057) is conjugate base of 13-deoxydaunorubicin(1+) (CHEBI:75297) |
| Incoming Relation(s) |
| 13-deoxydaunorubicin(1+) (CHEBI:75297) is conjugate acid of 13-deoxydaunorubicin (CHEBI:31057) |
| IUPAC Name |
|---|
| (1S,3S)-3-ethyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxy-α-L-lyxo-hexopyranoside |
| Synonym | Source |
|---|---|
| Feudomycin A | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00018343 | KNApSAcK |
| C12429 | KEGG COMPOUND |
| LMPK13050003 | LIPID MAPS |
| RU2233165 | Patent |
| US2006100421 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9029983 | Reaxys |
| CAS:79466-09-4 | KEGG COMPOUND |
| CAS:79466-09-4 | ChemIDplus |
| Citations |
|---|