EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6NO2S |
| Net Charge | -1 |
| Average Mass | 120.153 |
| Monoisotopic Mass | 120.01247 |
| SMILES | NC(CS)C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/p-1 |
| InChIKey | XUJNEKJLAYXESH-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cysteinate(1−) (CHEBI:32456) is a sulfur-containing amino-acid anion (CHEBI:63470) |
| cysteinate(1−) (CHEBI:32456) is a α-amino-acid anion (CHEBI:33558) |
| cysteinate(1−) (CHEBI:32456) is conjugate acid of cysteinate(2−) (CHEBI:32457) |
| cysteinate(1−) (CHEBI:32456) is conjugate base of cysteine (CHEBI:15356) |
| cysteinate(1−) (CHEBI:32456) is conjugate base of cysteine zwitterion (CHEBI:35237) |
| Incoming Relation(s) |
| D-cysteinate(1−) (CHEBI:32449) is a cysteinate(1−) (CHEBI:32456) |
| L-cysteinate(1−) (CHEBI:32442) is a cysteinate(1−) (CHEBI:32456) |
| cysteine (CHEBI:15356) is conjugate acid of cysteinate(1−) (CHEBI:32456) |
| cysteine zwitterion (CHEBI:35237) is conjugate acid of cysteinate(1−) (CHEBI:32456) |
| cysteinate(2−) (CHEBI:32457) is conjugate base of cysteinate(1−) (CHEBI:32456) |
| IUPAC Name |
|---|
| hydrogen cysteinate |
| Synonyms | Source |
|---|---|
| 2-amino-3-mercaptopropanoate | ChEBI |
| 2-amino-3-sulfanylpropanoate | IUPAC |
| cys− | IUPAC |
| cysteinate(1−) | JCBN |
| cysteine monoanion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:363235 | Gmelin |
| Reaxys:4128885 | Reaxys |