EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5NO2S |
| Net Charge | -2 |
| Average Mass | 119.145 |
| Monoisotopic Mass | 119.00520 |
| SMILES | N[C@H](C[S-])C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/p-2/t2-/m1/s1 |
| InChIKey | XUJNEKJLAYXESH-UWTATZPHSA-L |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-cysteinate(2−) (CHEBI:32450) has role fundamental metabolite (CHEBI:78675) |
| D-cysteinate(2−) (CHEBI:32450) is a cysteinate(2−) (CHEBI:32457) |
| D-cysteinate(2−) (CHEBI:32450) is conjugate base of D-cysteinate(1−) (CHEBI:32449) |
| D-cysteinate(2−) (CHEBI:32450) is enantiomer of L-cysteinate(2−) (CHEBI:32443) |
| Incoming Relation(s) |
| D-cysteinate(1−) (CHEBI:32449) is conjugate acid of D-cysteinate(2−) (CHEBI:32450) |
| L-cysteinate(2−) (CHEBI:32443) is enantiomer of D-cysteinate(2−) (CHEBI:32450) |
| IUPAC Name |
|---|
| D-cysteinate |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-sulfidopropanoate | IUPAC |
| D-cysteinate(2−) | JCBN |
| D-cysteine dianion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1342792 | Gmelin |