EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O8 |
| Net Charge | 0 |
| Average Mass | 210.138 |
| Monoisotopic Mass | 210.03757 |
| SMILES | O=C(O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)O |
| WURCS | WURCS=2.0/1,1,0/[A2112A]/1/ |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2+,3+,4- |
| InChIKey | DSLZVSRJTYRBFB-DUHBMQHGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23052862) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galactaric acid (CHEBI:30852) has role human metabolite (CHEBI:77746) |
| galactaric acid (CHEBI:30852) is a hexaric acid (CHEBI:24577) |
| galactaric acid (CHEBI:30852) is conjugate acid of galactarate(1−) (CHEBI:35390) |
| galactaric acid (CHEBI:30852) is conjugate acid of galactaric acid anion (CHEBI:48871) |
| Incoming Relation(s) |
| O-feruloylgalactaric acid (CHEBI:16590) has functional parent galactaric acid (CHEBI:30852) |
| D-galactaro-1,5-lactone (CHEBI:84190) has functional parent galactaric acid (CHEBI:30852) |
| 2-(E)-O-feruloyl-D-galactaric acid (CHEBI:52785) has functional parent galactaric acid (CHEBI:30852) |
| galactaric acid derivative (CHEBI:24138) has functional parent galactaric acid (CHEBI:30852) |
| galactarate(1−) (CHEBI:35390) is conjugate base of galactaric acid (CHEBI:30852) |
| galactaric acid anion (CHEBI:48871) is conjugate base of galactaric acid (CHEBI:30852) |
| IUPAC Names |
|---|
| (2R,3S,4R,5S)-2,3,4,5-tetrahydroxyhexanedioic acid |
| meso-galactaric acid |
| Synonyms | Source |
|---|---|
| ácido galactárico | ChEBI |
| ácido múcico | ChEBI |
| Galactaric acid | KEGG COMPOUND |
| Galactarsäure | ChEBI |
| Galactosaccharic acid | HMDB |
| Galaktarsäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00879 | KEGG COMPOUND |
| D-GALACTARATE | MetaCyc |
| Galactaric_acid | Wikipedia |
| HMDB0000639 | HMDB |
| WO2010072902 | Patent |
| Citations |
|---|