EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O8 |
| Net Charge | -1 |
| Average Mass | 209.130 |
| Monoisotopic Mass | 209.03029 |
| SMILES | O=C(O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/p-1/t1-,2+,3+,4- |
| InChIKey | DSLZVSRJTYRBFB-DUHBMQHGSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galactarate(1−) (CHEBI:35390) has role human metabolite (CHEBI:77746) |
| galactarate(1−) (CHEBI:35390) is a dicarboxylic acid monoanion (CHEBI:35695) |
| galactarate(1−) (CHEBI:35390) is a galactaric acid anion (CHEBI:48871) |
| galactarate(1−) (CHEBI:35390) is conjugate acid of galactarate(2−) (CHEBI:16537) |
| galactarate(1−) (CHEBI:35390) is conjugate base of galactaric acid (CHEBI:30852) |
| Incoming Relation(s) |
| galactaric acid (CHEBI:30852) is conjugate acid of galactarate(1−) (CHEBI:35390) |
| galactarate(2−) (CHEBI:16537) is conjugate base of galactarate(1−) (CHEBI:35390) |
| IUPAC Names |
|---|
| (2R,3S,4R,5S)-5-carboxy-2,3,4,5-tetrahydroxypentanoate |
| hydrogen meso-galactarate |