EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O7 |
| Net Charge | 0 |
| Average Mass | 192.123 |
| Monoisotopic Mass | 192.02700 |
| SMILES | O=C(O)[C@H]1OC(=O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H8O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,7-9H,(H,10,11)/t1-,2+,3+,4-/m0/s1 |
| InChIKey | YLKFQNUGXOLRNI-KXMYSMCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Agrobacterium tumefaciens (ncbitaxon:358) | - | PubMed (24450804) | Strain: C58 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-galactaro-1,5-lactone (CHEBI:84190) has functional parent galactaric acid (CHEBI:30852) |
| D-galactaro-1,5-lactone (CHEBI:84190) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| D-galactaro-1,5-lactone (CHEBI:84190) is a aldarolactone (CHEBI:37426) |
| D-galactaro-1,5-lactone (CHEBI:84190) is a carbohydrate acid (CHEBI:33720) |
| D-galactaro-1,5-lactone (CHEBI:84190) is conjugate acid of D-galactaro-1,5-lactone(1−) (CHEBI:83383) |
| Incoming Relation(s) |
| D-galactaro-1,5-lactone(1−) (CHEBI:83383) is conjugate base of D-galactaro-1,5-lactone (CHEBI:84190) |
| Synonyms | Source |
|---|---|
| 1,5-galactarolactone | MetaCyc |
| (2S,3R,4S,5R)-3,4,5-trihydroxy-6-oxotetrahydro-2H-pyran-2-carboxylic acid | IUPAC |
| galactaro-1,5-lactone | MetaCyc |
| galactarolactone | MetaCyc |
| Citations |
|---|