EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O11 |
| Net Charge | 0 |
| Average Mass | 386.309 |
| Monoisotopic Mass | 386.08491 |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H](C(=O)O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O)ccc1O |
| InChI | InChI=1S/C16H18O11/c1-26-9-6-7(2-4-8(9)17)3-5-10(18)27-14(16(24)25)12(20)11(19)13(21)15(22)23/h2-6,11-14,17,19-21H,1H3,(H,22,23)(H,24,25)/b5-3+/t11-,12+,13+,14-/m1/s1 |
| InChIKey | JZRAOXRUPYISEN-MOEPPVLCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(E)-O-feruloyl-D-galactaric acid (CHEBI:52785) has functional parent galactaric acid (CHEBI:30852) |
| 2-(E)-O-feruloyl-D-galactaric acid (CHEBI:52785) is a O-feruloylgalactaric acid (CHEBI:16590) |
| 2-(E)-O-feruloyl-D-galactaric acid (CHEBI:52785) is conjugate acid of 2-(E)-O-feruloyl-D-galactarate(2−) (CHEBI:58901) |
| Incoming Relation(s) |
| 2-(E)-O-feruloyl-D-galactarate(2−) (CHEBI:58901) is conjugate base of 2-(E)-O-feruloyl-D-galactaric acid (CHEBI:52785) |
| IUPAC Name |
|---|
| 2-O-[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-D-galactaric acid |
| Synonyms | Source |
|---|---|
| 2'-(E)-O-Feruloyl-D-galactaric acid | KEGG COMPOUND |
| O-Feruloylgalactaric acid | KEGG COMPOUND |
| 2'-(E)-O-Feruloylgalactaric acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03156 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6772911 | Beilstein |
| Citations |
|---|