EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)cc1O |
| InChI | InChI=1S/C16H14O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1 |
| InChIKey | AIONOLUJZLIMTK-AWEZNQCLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hesperetin (CHEBI:28230) has role antineoplastic agent (CHEBI:35610) |
| hesperetin (CHEBI:28230) has role antioxidant (CHEBI:22586) |
| hesperetin (CHEBI:28230) has role plant metabolite (CHEBI:76924) |
| hesperetin (CHEBI:28230) is a 3'-hydroxyflavanones (CHEBI:48024) |
| hesperetin (CHEBI:28230) is a 4'-methoxyflavanones (CHEBI:140332) |
| hesperetin (CHEBI:28230) is a monomethoxyflavanone (CHEBI:38738) |
| hesperetin (CHEBI:28230) is a trihydroxyflavanone (CHEBI:38739) |
| hesperetin (CHEBI:28230) is conjugate acid of hesperetin(1−) (CHEBI:61249) |
| Incoming Relation(s) |
| (2S)-5,7,3'-trihydroxy-4'-methoxy-8-(3''-methylbut-2''-enyl)-flavonone (CHEBI:70018) has functional parent hesperetin (CHEBI:28230) |
| hesperetin 7-O-β-D-glucoside (CHEBI:59015) has functional parent hesperetin (CHEBI:28230) |
| hesperidin (CHEBI:28775) has functional parent hesperetin (CHEBI:28230) |
| neohesperidin (CHEBI:59016) has functional parent hesperetin (CHEBI:28230) |
| hesperetin(1−) (CHEBI:61249) is conjugate base of hesperetin (CHEBI:28230) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',5,7-Trihydroxy-4'-methoxyflavanone | KEGG COMPOUND |
| (−)-hesperetin | ChEBI |
| Hesperetin | KEGG COMPOUND |
| (S)-2,3-dihydro-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| (−)-(S)-hesperetin | ChEBI |
| UniProt Name | Source |
|---|---|
| (2S)-hesperetin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1362 | DrugCentral |
| C00000968 | KNApSAcK |
| C01709 | KEGG COMPOUND |
| CPD-7072 | MetaCyc |
| DB01094 | DrugBank |
| Hesperetin | Wikipedia |
| HMDB0005782 | HMDB |
| LMPK12140003 | LIPID MAPS |
| LSM-20933 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:92705 | Reaxys |
| CAS:520-33-2 | ChemIDplus |
| CAS:520-33-2 | KEGG COMPOUND |
| Citations |
|---|