EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O15 |
| Net Charge | 0 |
| Average Mass | 610.565 |
| Monoisotopic Mass | 610.18977 |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(O)cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)cc3O2)cc1O |
| InChI | InChI=1S/C28H34O15/c1-10-21(33)23(35)25(37)27(39-10)43-26-24(36)22(34)19(9-29)42-28(26)40-12-6-14(31)20-15(32)8-17(41-18(20)7-12)11-3-4-16(38-2)13(30)5-11/h3-7,10,17,19,21-31,33-37H,8-9H2,1-2H3/t10-,17-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | ARGKVCXINMKCAZ-UZRWAPQLSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neohesperidin (CHEBI:59016) has functional parent hesperetin (CHEBI:28230) |
| neohesperidin (CHEBI:59016) has role antineoplastic agent (CHEBI:35610) |
| neohesperidin (CHEBI:59016) has role plant metabolite (CHEBI:76924) |
| neohesperidin (CHEBI:59016) is a 3'-hydroxyflavanones (CHEBI:48024) |
| neohesperidin (CHEBI:59016) is a 4'-methoxyflavanones (CHEBI:140332) |
| neohesperidin (CHEBI:59016) is a dihydroxyflavanone (CHEBI:38749) |
| neohesperidin (CHEBI:59016) is a disaccharide derivative (CHEBI:63353) |
| neohesperidin (CHEBI:59016) is a flavanone glycoside (CHEBI:72730) |
| neohesperidin (CHEBI:59016) is a monomethoxyflavanone (CHEBI:38738) |
| neohesperidin (CHEBI:59016) is a neohesperidoside (CHEBI:25495) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-7-yl 2-O-(α-L-rhamnopyranosyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Neohesperidin | KEGG COMPOUND |
| Hesperetin 7-O-neohesperidoside | KEGG COMPOUND |
| (S)-7-(((2-O-6-Deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl)oxy)-2,3-dihydro-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C09806 | KEGG COMPOUND |
| CPD-7074 | MetaCyc |
| HMDB0030748 | HMDB |
| LMPK12140452 | LIPID MAPS |
| C00000987 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1279600 | Reaxys |
| CAS:13241-33-3 | KEGG COMPOUND |
| CAS:13241-33-3 | ChemIDplus |
| Citations |
|---|