EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O11 |
| Net Charge | 0 |
| Average Mass | 464.423 |
| Monoisotopic Mass | 464.13186 |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(O)cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc3O2)cc1O |
| InChI | InChI=1S/C22H24O11/c1-30-14-3-2-9(4-11(14)24)15-7-13(26)18-12(25)5-10(6-16(18)32-15)31-22-21(29)20(28)19(27)17(8-23)33-22/h2-6,15,17,19-25,27-29H,7-8H2,1H3/t15-,17+,19+,20-,21+,22+/m0/s1 |
| InChIKey | ADSYMQORONDIDD-ZJHVPRRPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hesperetin 7-O-β-D-glucoside (CHEBI:59015) has functional parent hesperetin (CHEBI:28230) |
| hesperetin 7-O-β-D-glucoside (CHEBI:59015) has role metabolite (CHEBI:25212) |
| hesperetin 7-O-β-D-glucoside (CHEBI:59015) is a 3'-hydroxyflavanones (CHEBI:48024) |
| hesperetin 7-O-β-D-glucoside (CHEBI:59015) is a 4'-methoxyflavanones (CHEBI:140332) |
| hesperetin 7-O-β-D-glucoside (CHEBI:59015) is a dihydroxyflavanone (CHEBI:38749) |
| hesperetin 7-O-β-D-glucoside (CHEBI:59015) is a flavanone 7-O-β-D-glucoside (CHEBI:13637) |
| hesperetin 7-O-β-D-glucoside (CHEBI:59015) is a monomethoxyflavanone (CHEBI:38738) |
| hesperetin 7-O-β-D-glucoside (CHEBI:59015) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-7-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Eriodictiol-7-glucoside | ChemIDplus |
| Hesperetin 7-O-glucoside | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (2S)-hesperetin 7-O-β-D-glucoside | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00008297 | KNApSAcK |
| C16422 | KEGG COMPOUND |
| HMDB0030747 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8661664 | Reaxys |
| CAS:31712-49-9 | KEGG COMPOUND |
| CAS:31712-49-9 | ChemIDplus |
| Citations |
|---|