EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O15 |
| Net Charge | 0 |
| Average Mass | 610.565 |
| Monoisotopic Mass | 610.18977 |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(O)cc(O[C@@H]4O[C@H](CO[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)cc3O2)cc1O |
| InChI | InChI=1S/C28H34O15/c1-10-21(32)23(34)25(36)27(40-10)39-9-19-22(33)24(35)26(37)28(43-19)41-12-6-14(30)20-15(31)8-17(42-18(20)7-12)11-3-4-16(38-2)13(29)5-11/h3-7,10,17,19,21-30,32-37H,8-9H2,1-2H3/t10-,17-,19+,21-,22+,23+,24-,25+,26+,27+,28+/m0/s1 |
| InChIKey | QUQPHWDTPGMPEX-QJBIFVCTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hesperidin (CHEBI:28775) has functional parent hesperetin (CHEBI:28230) |
| hesperidin (CHEBI:28775) has role antirheumatic drug (CHEBI:35842) |
| hesperidin (CHEBI:28775) has role bone density conservation agent (CHEBI:50646) |
| hesperidin (CHEBI:28775) has role mutagen (CHEBI:25435) |
| hesperidin (CHEBI:28775) is a 3'-hydroxyflavanones (CHEBI:48024) |
| hesperidin (CHEBI:28775) is a 4'-methoxyflavanones (CHEBI:140332) |
| hesperidin (CHEBI:28775) is a dihydroxyflavanone (CHEBI:38749) |
| hesperidin (CHEBI:28775) is a disaccharide derivative (CHEBI:63353) |
| hesperidin (CHEBI:28775) is a flavanone glycoside (CHEBI:72730) |
| hesperidin (CHEBI:28775) is a monomethoxyflavanone (CHEBI:38738) |
| hesperidin (CHEBI:28775) is a rutinoside (CHEBI:26587) |
| Incoming Relation(s) |
| methyl hesperidin (CHEBI:81056) has functional parent hesperidin (CHEBI:28775) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-7-yl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Cirantin | ChemIDplus |
| Ciratin | KEGG COMPOUND |
| Hesperetin 7-O-rutinoside | KEGG COMPOUND |
| Hesperidin | KEGG COMPOUND |
| Hesperidoside | ChemIDplus |
| NSC-31048 | ChEMBL |
| Brand Name | Source |
|---|---|
| Diosvein | ChEMBL |
| UniProt Name | Source |
|---|---|
| (2S)-hesperidin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000970 | KNApSAcK |
| C09755 | KEGG COMPOUND |
| CPD-7075 | MetaCyc |
| D01038 | KEGG DRUG |
| DB04703 | DrugBank |
| Hesperidin | Wikipedia |
| HMDB0003265 | HMDB |
| LSM-2858 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:75140 | Reaxys |
| CAS:520-26-3 | KEGG COMPOUND |
| CAS:520-26-3 | ChemIDplus |
| Citations |
|---|