EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13O6 |
| Net Charge | -1 |
| Average Mass | 301.274 |
| Monoisotopic Mass | 301.07176 |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(O)cc([O-])cc3O2)cc1O |
| InChI | InChI=1S/C16H14O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-6,14,17-19H,7H2,1H3/p-1/t14-/m0/s1 |
| InChIKey | AIONOLUJZLIMTK-AWEZNQCLSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hesperetin(1−) (CHEBI:61249) is a flavonoid oxoanion (CHEBI:60038) |
| hesperetin(1−) (CHEBI:61249) is conjugate base of hesperetin (CHEBI:28230) |
| Incoming Relation(s) |
| hesperetin (CHEBI:28230) is conjugate acid of hesperetin(1−) (CHEBI:61249) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxochroman-7-olate |
| Synonym | Source |
|---|---|
| hesperetin anion | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-7072 | MetaCyc |