EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O2 |
| Net Charge | 0 |
| Average Mass | 278.436 |
| Monoisotopic Mass | 278.22458 |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9- |
| InChIKey | DTOSIQBPPRVQHS-PDBXOOCHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-linolenic acid (CHEBI:27432) has role micronutrient (CHEBI:27027) |
| α-linolenic acid (CHEBI:27432) has role mouse metabolite (CHEBI:75771) |
| α-linolenic acid (CHEBI:27432) has role nutraceutical (CHEBI:50733) |
| α-linolenic acid (CHEBI:27432) is a linolenic acid (CHEBI:25048) |
| α-linolenic acid (CHEBI:27432) is a ω−3 fatty acid (CHEBI:25681) |
| α-linolenic acid (CHEBI:27432) is conjugate acid of (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (CHEBI:528881) |
| α-linolenic acid (CHEBI:27432) is conjugate acid of α-linolenate (CHEBI:32387) |
| Incoming Relation(s) |
| (R)-2-hydroperoxy-α-linolenic acid (CHEBI:76236) has functional parent α-linolenic acid (CHEBI:27432) |
| (R)-2-hydroxy-α-linolenic acid (CHEBI:76234) has functional parent α-linolenic acid (CHEBI:27432) |
| (9Z,11R,12Z,15Z)-11-hydroperoxyoctadecatrienoic acid (CHEBI:133988) has functional parent α-linolenic acid (CHEBI:27432) |
| (9Z,11S,12Z,15Z)-11-hydroperoxyoctadecatrienoic acid (CHEBI:136686) has functional parent α-linolenic acid (CHEBI:27432) |
| (9Z,12Z,15Z)-octadecatrienamide (CHEBI:142684) has functional parent α-linolenic acid (CHEBI:27432) |
| N-(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl-(2S)-hydroxyglycine (CHEBI:142735) has functional parent α-linolenic acid (CHEBI:27432) |
| N-(9Z,12Z,15Z)-octadecatrienoylglycine (CHEBI:142736) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-(9Z,12Z,15Z-octadecatrienoyl)-2-hexadecanoyl-3-[α-D-galactosyl-(1→6)-β-D-galactosyl]-sn-glycerol (CHEBI:136797) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-(9Z,12Z,15Z)-octadecatrienoyl-2-(7Z,10Z,13Z)-hexadecatrienoyl-3-(β-D-galactosyl)-sn-glycerol (CHEBI:90552) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-[(9Z,12Z,15Z)-octadecatrienoyl]-2-[(9Z)-octadecenoyl]- sn -glycero-3-phosphocholine (CHEBI:86127) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-[(9Z)-octadecenoyl]-2-[(9Z,12Z,15Z)-octadecatrienoyl]-sn-glycero-3-phosphocholine (CHEBI:86133) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-heptadecanoyl-2-[(9Z,12Z,15Z)-octadecatrienoyl]-sn-glycero-3-phosphocholine (CHEBI:131660) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-linolenoyl-sn-glycero-3-phosphate (CHEBI:74831) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-linolenoyl-2-oleoyl-sn-glycero-3-phosphate (CHEBI:74833) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-linolenyl-2-linoleyl-PAP (CHEBI:53755) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-oleoyl-2-(α-linolenoyl)-sn-glycerol (CHEBI:75475) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-oleoyl-2-linolenoyl-PAP (CHEBI:53754) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-palmitoyl-2-[(9Z,12Z,15Z)-octadecatrienoyl]-sn-glycero-3-phosphocholine (CHEBI:84789) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-stearoyl-2-(α-linolenoyl)-sn-glycero-3-phosphocholine (CHEBI:78022) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-tetradecanoyl-2-[(9Z,12Z,15Z)-octadecatrienoyl]-sn-glycero-3-phosphocholine (CHEBI:86095) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-α-linolenoyl-2-[(11Z,14Z)-icosadienoyl]-sn-glycerol (CHEBI:89239) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-α-linolenoyl-2-[(11Z)-icosenoyl]-sn-glycerol (CHEBI:89240) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-α-linolenoyl-2-[(5Z,8Z,11Z)-icosatrienoyl]-sn-glycerol (CHEBI:89238) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-α-linolenoyl-2-[(8Z,11Z,14Z)-icosatrienoyl]-sn-glycerol (CHEBI:89237) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-α-linolenoyl-2-hexadecanoylphosphatidylglycerol (CHEBI:136802) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-α-linolenoyl-2-icosanoyl-sn-glycerol (CHEBI:89241) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-α-linolenoyl-2-oleoylglycerol (CHEBI:75609) has functional parent α-linolenic acid (CHEBI:27432) |
| 1-α-linolenoylglycerol (CHEBI:75610) has functional parent α-linolenic acid (CHEBI:27432) |
| 1,2-di-(α-linolenoyl)-3-[α-D-galactosyl-(1→6)-β-D-galactosyl]-sn-glycerol (CHEBI:136795) has functional parent α-linolenic acid (CHEBI:27432) |
| 1,2-di-[(9Z,12Z,15Z)-octadecatrienoyl]-sn-glycero-3-phosphocholine (CHEBI:86161) has functional parent α-linolenic acid (CHEBI:27432) |
| 1,2,3-trilinolenoylglycerol (CHEBI:75845) has functional parent α-linolenic acid (CHEBI:27432) |
| 1,3-dilinolenoylglycerol (CHEBI:75852) has functional parent α-linolenic acid (CHEBI:27432) |
| 2-α-linolenoylglycerol (CHEBI:75474) has functional parent α-linolenic acid (CHEBI:27432) |
| 2,3-dilinolenoyl-sn-glycerol (CHEBI:75855) has functional parent α-linolenic acid (CHEBI:27432) |
| cholesteryl linolenate (CHEBI:84341) has functional parent α-linolenic acid (CHEBI:27432) |
| ethyl linolenate (CHEBI:84851) has functional parent α-linolenic acid (CHEBI:27432) |
| linolenic acid anilide (CHEBI:53751) has functional parent α-linolenic acid (CHEBI:27432) |
| methyl linolenate (CHEBI:133634) has functional parent α-linolenic acid (CHEBI:27432) |
| α-linolenoyl bioconjugate (CHEBI:76184) has functional parent α-linolenic acid (CHEBI:27432) |
| α-linolenoyl-sn-glycero-3-phosphocholine (CHEBI:140445) has functional parent α-linolenic acid (CHEBI:27432) |
| α-linolenoyl-CoA (CHEBI:51985) has functional parent α-linolenic acid (CHEBI:27432) |
| α-linolenoyl-containing glycerolipid (CHEBI:90078) has functional parent α-linolenic acid (CHEBI:27432) |
| soybean oil (CHEBI:166975) has part α-linolenic acid (CHEBI:27432) |
| (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (CHEBI:528881) is conjugate base of α-linolenic acid (CHEBI:27432) |
| α-linolenate (CHEBI:32387) is conjugate base of α-linolenic acid (CHEBI:27432) |
| α-linolenoyl group (CHEBI:32388) is substituent group from α-linolenic acid (CHEBI:27432) |
| IUPAC Name |
|---|
| (9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid |
| Synonyms | Source |
|---|---|
| alpha-Linolenic acid | KEGG COMPOUND |
| 9,12,15-Octadecatrienoic acid | KEGG COMPOUND |
| (Z,Z,Z)-9,12,15-octadecatrienoic acid | NIST Chemistry WebBook |
| cis,cis,cis-9,12,15-octadecatrienoic acid | NIST Chemistry WebBook |
| all-cis-9,12,15-octadecatrienoic acid | NIST Chemistry WebBook |
| (9,12,15)-linolenic acid | IUBMB |
| Manual Xrefs | Databases |
|---|---|
| C06427 | KEGG COMPOUND |
| LNL | PDBeChem |
| LMFA01030152 | LIPID MAPS |
| DB00132 | DrugBank |
| LINOLENIC_ACID | MetaCyc |
| HMDB0001388 | HMDB |
| Alpha-Linolenic_acid | Wikipedia |
| C00007247 | KNApSAcK |
| 4618 | DrugCentral |
| Citations |
|---|