EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O2 |
| Net Charge | 0 |
| Average Mass | 306.490 |
| Monoisotopic Mass | 306.25588 |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCC |
| InChI | InChI=1S/C20H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h5-6,8-9,11-12H,3-4,7,10,13-19H2,1-2H3/b6-5-,9-8-,12-11- |
| InChIKey | JYYFMIOPGOFNPK-AGRJPVHOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25596105) | |
| Aglaia odorata (ncbitaxon:210347) | flower (BTO:0000469) | PubMed (17679444) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl linolenate (CHEBI:84851) has functional parent α-linolenic acid (CHEBI:27432) |
| ethyl linolenate (CHEBI:84851) has role human metabolite (CHEBI:77746) |
| ethyl linolenate (CHEBI:84851) has role plant metabolite (CHEBI:76924) |
| ethyl linolenate (CHEBI:84851) is a long-chain fatty acid ethyl ester (CHEBI:13209) |
| IUPAC Name |
|---|
| ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| Synonyms | Source |
|---|---|
| ethyl (9Z,12Z,15Z)-octadecatrienoate | ChEBI |
| Linolenic acid, ethyl ester | ChemIDplus |
| Ethyl (9Z,12Z,15Z)-9,12,15-octadecatrienoate | ChemIDplus |
| Ethyl (Z,Z,Z)-9,12,15-octadecatrienoate | ChemIDplus |
| ethyl α-linolenate | NIST Chemistry WebBook |
| Ethyl cis,cis,cis-9,12,15-octadecatrienoate | NIST Chemistry WebBook |
| Citations |
|---|