EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O2 |
| Net Charge | 0 |
| Average Mass | 292.463 |
| Monoisotopic Mass | 292.24023 |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h4-5,7-8,10-11H,3,6,9,12-18H2,1-2H3/b5-4-,8-7-,11-10- |
| InChIKey | DVWSXZIHSUZZKJ-YSTUJMKBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) | |
| Panax ginseng (ncbitaxon:4054) | stem (BTO:0001300) | PubMed (27914541) | |
| Salvia argentea (ncbitaxon:49208) | aerial part (BTO:0001658) | PubMed (25880372) | |
| Syzygium antisepticum (ncbitaxon:1042136) | whole plant (BTO:0001461) | PubMed (28294414) | |
| Syzygium jambos (ncbitaxon:334483) | whole plant (BTO:0001461) | PubMed (28294414) |
| Roles Classification |
|---|
| Biological Roles: | insect attractant A chemical that attracts insects. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl linolenate (CHEBI:133634) has functional parent α-linolenic acid (CHEBI:27432) |
| methyl linolenate (CHEBI:133634) has role insect attractant (CHEBI:24850) |
| methyl linolenate (CHEBI:133634) has role plant metabolite (CHEBI:76924) |
| methyl linolenate (CHEBI:133634) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| Synonyms | Source |
|---|---|
| alpha-Linolenic acid methyl ester | ChemIDplus |
| cis,cis,cis-9,12,15-Octadecatrienoic acid, methyl ester | NIST Chemistry WebBook |
| Linolenic acid, methyl ester | NIST Chemistry WebBook |
| methyl (9Z,12Z,15Z)-octadecatrienoate | ChEBI |
| methyl (9Z,12Z,15Z)-9,12,15-octadecatrienoate | NIST Chemistry WebBook |
| Methyl all-cis-9,12,15-octadecatrienoate | NIST Chemistry WebBook |
| Citations |
|---|