EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29O2 |
| Net Charge | -1 |
| Average Mass | 277.428 |
| Monoisotopic Mass | 277.21730 |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/p-1/b4-3-,7-6-,10-9- |
| InChIKey | DTOSIQBPPRVQHS-PDBXOOCHSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-linolenate (CHEBI:32387) has role human metabolite (CHEBI:77746) |
| α-linolenate (CHEBI:32387) is a linolenate (CHEBI:133790) |
| α-linolenate (CHEBI:32387) is conjugate base of α-linolenic acid (CHEBI:27432) |
| Incoming Relation(s) |
| (R)-2-hydroperoxy-α-linolenate (CHEBI:76161) has functional parent α-linolenate (CHEBI:32387) |
| (R)-2-hydroxy-α-linolenate (CHEBI:76150) has functional parent α-linolenate (CHEBI:32387) |
| (3R)-hydroxy-(9Z,12Z,15Z)-octadecatrienoyl-CoA(4-) (CHEBI:760590) has functional parent α-linolenate (CHEBI:32387) |
| (9Z,11R,12Z,15Z)-11-hydroperoxyoctadecatrienoate (CHEBI:133989) has functional parent α-linolenate (CHEBI:32387) |
| (9Z,11S,12Z,15Z)-11-hydroperoxyoctadecatrienoate (CHEBI:134110) has functional parent α-linolenate (CHEBI:32387) |
| 1,2-di-(9Z,12Z,15Z-octadecatrienoyl)-sn-glycero-3-phospho-N-methylethanolamine zwitterion (CHEBI:189859) has functional parent α-linolenate (CHEBI:32387) |
| 1,2-di-(9Z,12Z,15Z-octadecatrienoyl)-sn-glycero-3-phospho-N,N-dimethylethanolamine zwitterion (CHEBI:189860) has functional parent α-linolenate (CHEBI:32387) |
| 1,2-di-(9Z,12Z,15Z-octadecatrienoyl)-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:189858) has functional parent α-linolenate (CHEBI:32387) |
| 12,13-DiHODE(1-) (CHEBI:747178) has functional parent α-linolenate (CHEBI:32387) |
| 12(R)-HPOTrE(9Z,13E,15Z)(1-) (CHEBI:747862) has functional parent α-linolenate (CHEBI:32387) |
| α-linolenic acid (CHEBI:27432) is conjugate acid of α-linolenate (CHEBI:32387) |
| IUPAC Name |
|---|
| (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| Synonyms | Source |
|---|---|
| (9,12,15)-linolenate | IUBMB |
| all-cis--9,12,15-octadecatrienoate | ChEBI |
| cis,cis,cis-9,12,15-octadecatrienoate | ChEBI |
| linolenate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (9Z,12Z,15Z)-octadecatrienoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:377245 | Gmelin |