EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O2 |
| Net Charge | 0 |
| Average Mass | 300.442 |
| Monoisotopic Mass | 300.20893 |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)O |
| InChI | InChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22) |
| InChIKey | SHGAZHPCJJPHSC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24506204) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| retinoic acid (CHEBI:26536) has role human metabolite (CHEBI:77746) |
| retinoic acid (CHEBI:26536) is a retinoid (CHEBI:26537) |
| retinoic acid (CHEBI:26536) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| retinoic acid (CHEBI:26536) is conjugate acid of retinoate (CHEBI:15036) |
| Incoming Relation(s) |
| all-trans-retinoic acid (CHEBI:15367) is a retinoic acid (CHEBI:26536) |
| 11-cis-retinoic acid (CHEBI:46856) is a retinoic acid (CHEBI:26536) |
| 9-cis-retinoic acid (CHEBI:50648) is a retinoic acid (CHEBI:26536) |
| isotretinoin (CHEBI:6067) is a retinoic acid (CHEBI:26536) |
| retinoate (CHEBI:15036) is conjugate base of retinoic acid (CHEBI:26536) |
| IUPAC Name |
|---|
| 3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| LSM-2135 | LINCS |
| Citations |
|---|