EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O2 |
| Net Charge | 0 |
| Average Mass | 300.442 |
| Monoisotopic Mass | 300.20893 |
| SMILES | CC1=C(/C=C/C(C)=C\C=C\C(C)=C\C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/b9-6+,12-11+,15-8-,16-14+ |
| InChIKey | SHGAZHPCJJPHSC-ZVCIMWCZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | retinoid X receptor agonist An agonist that selectively binds to and activates a retinoid X receptor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antipsoriatic A drug used to treat psoriasis. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. keratolytic drug A drug that softens, separates, and causes desquamation of the cornified epithelium or horny layer of skin. Keratolytic drugs are used to expose mycelia of infecting fungi or to treat corns, warts, and certain other skin diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-cis-retinoic acid (CHEBI:50648) has role antineoplastic agent (CHEBI:35610) |
| 9-cis-retinoic acid (CHEBI:50648) has role antipsoriatic (CHEBI:50748) |
| 9-cis-retinoic acid (CHEBI:50648) has role dermatologic drug (CHEBI:50177) |
| 9-cis-retinoic acid (CHEBI:50648) has role keratolytic drug (CHEBI:50176) |
| 9-cis-retinoic acid (CHEBI:50648) has role metabolite (CHEBI:25212) |
| 9-cis-retinoic acid (CHEBI:50648) has role retinoid X receptor agonist (CHEBI:63794) |
| 9-cis-retinoic acid (CHEBI:50648) is a retinoic acid (CHEBI:26536) |
| 9-cis-retinoic acid (CHEBI:50648) is conjugate acid of 9-cis-retinoate (CHEBI:78630) |
| Incoming Relation(s) |
| 9-cis-4-hydroxyretinoic acid (CHEBI:63802) has functional parent 9-cis-retinoic acid (CHEBI:50648) |
| 9-cis-4-oxoretinoic acid (CHEBI:139255) has functional parent 9-cis-retinoic acid (CHEBI:50648) |
| 9-cis-retinoyl-β-D-glucuronide (CHEBI:172945) has functional parent 9-cis-retinoic acid (CHEBI:50648) |
| 9-cis-retinoate (CHEBI:78630) is conjugate base of 9-cis-retinoic acid (CHEBI:50648) |
| IUPAC Name |
|---|
| (9cis)-retinoic acid |
| INNs | Source |
|---|---|
| alitretinoína | ChEBI |
| alitrétinoïne | ChEBI |
| alitretinoinum | ChEBI |
| Synonyms | Source |
|---|---|
| (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenoic acid | IUPAC |
| (7E,9Z,11E,13E)-retinoic acid | ChEBI |
| 9-cis retinoic acid | ChEMBL |
| 9-cis-retinoic acid | ChEMBL |
| 9-cis-Tretinoin | ChemIDplus |
| 9(Z)-Retinoic acid | ChemIDplus |
| Brand Names | Source |
|---|---|
| Panretin | DrugBank |
| Panretyn | DrugBank |
| Toctino | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3862 | DrugCentral |
| Alitretinoin | Wikipedia |
| C15493 | KEGG COMPOUND |
| D02815 | KEGG DRUG |
| DB00523 | DrugBank |
| HMDB0002369 | HMDB |
| LMPR01090022 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2057222 | Reaxys |
| CAS:5300-03-8 | KEGG COMPOUND |
| CAS:5300-03-8 | ChemIDplus |
| Citations |
|---|