EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O2 |
| Net Charge | 0 |
| Average Mass | 300.442 |
| Monoisotopic Mass | 300.20893 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C\C(C)=C\C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/b9-6-,12-11+,15-8+,16-14+ |
| InChIKey | SHGAZHPCJJPHSC-JPXMXQIXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-cis-retinoic acid (CHEBI:46856) is a retinoic acid (CHEBI:26536) |
| 11-cis-retinoic acid (CHEBI:46856) is conjugate acid of 11-cis-retinoate (CHEBI:87435) |
| Incoming Relation(s) |
| 11-cis-retinoate (CHEBI:87435) is conjugate base of 11-cis-retinoic acid (CHEBI:46856) |
| IUPAC Name |
|---|
| (2E,4Z,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid |
| Synonyms | Source |
|---|---|
| (11Z)-retinoic acid | ChEBI |
| (7E,9E,11Z,13E)-retinoic acid | JCBN |
| Manual Xrefs | Databases |
|---|---|
| LMPR01090024 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2622578 | Reaxys |