EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O2 |
| Net Charge | 0 |
| Average Mass | 300.442 |
| Monoisotopic Mass | 300.20893 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C\C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/b9-6+,12-11+,15-8+,16-14- |
| InChIKey | SHGAZHPCJJPHSC-XFYACQKRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antiviral agent A substance that destroys or inhibits replication of viruses. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. keratolytic drug A drug that softens, separates, and causes desquamation of the cornified epithelium or horny layer of skin. Keratolytic drugs are used to expose mycelia of infecting fungi or to treat corns, warts, and certain other skin diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isotretinoin (CHEBI:6067) has role anti-HIV agent (CHEBI:64946) |
| isotretinoin (CHEBI:6067) has role antifungal agent (CHEBI:35718) |
| isotretinoin (CHEBI:6067) has role antiinfective agent (CHEBI:35441) |
| isotretinoin (CHEBI:6067) has role antineoplastic agent (CHEBI:35610) |
| isotretinoin (CHEBI:6067) has role antiviral agent (CHEBI:22587) |
| isotretinoin (CHEBI:6067) has role keratolytic drug (CHEBI:50176) |
| isotretinoin (CHEBI:6067) has role teratogenic agent (CHEBI:50905) |
| isotretinoin (CHEBI:6067) is a retinoic acid (CHEBI:26536) |
| isotretinoin (CHEBI:6067) is conjugate acid of 13-cis-retinoate (CHEBI:169952) |
| Incoming Relation(s) |
| 13-cis-retinoate (CHEBI:169952) is conjugate base of isotretinoin (CHEBI:6067) |
| IUPAC Name |
|---|
| (2Z,4E6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid |
| INNs | Source |
|---|---|
| isotretinoin | ChemIDplus |
| isotretinoína | WHO MedNet |
| isotrétinoine | WHO MedNet |
| isotretinoinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 13 cis-retinoic acid | ChEMBL |
| 13-cis-Vitamin A acid | ChemIDplus |
| 13-cis-retinoic acid | JCBN |
| 13-RA | ChemIDplus |
| (7E,9E,11E,13Z)-retinoic acid | JCBN |
| cis-RA | ChEBI |
| Brand Names | Source |
|---|---|
| Absorica | ChEMBL |
| Absorica ld | ChEMBL |
| Accutane | DrugBank |
| Amnesteem | DrugBank |
| Claravis | DrugBank |
| Myorisan | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1508 | DrugCentral |
| D00348 | KEGG DRUG |
| DB00982 | DrugBank |
| EP111325 | Patent |
| HMDB0006219 | HMDB |
| Isotretinoin | Wikipedia |
| LMPR01090021 | LIPID MAPS |
| US4556518 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1885770 | Reaxys |
| CAS:4759-48-2 | ChemIDplus |
| Citations |
|---|