EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O2 |
| Net Charge | 0 |
| Average Mass | 300.442 |
| Monoisotopic Mass | 300.20893 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C\C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/b9-6+,12-11+,15-8+,16-14- |
| InChIKey | SHGAZHPCJJPHSC-XFYACQKRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | keratolytic drug A drug that softens, separates, and causes desquamation of the cornified epithelium or horny layer of skin. Keratolytic drugs are used to expose mycelia of infecting fungi or to treat corns, warts, and certain other skin diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isotretinoin (CHEBI:6067) has role antineoplastic agent (CHEBI:35610) |
| isotretinoin (CHEBI:6067) has role keratolytic drug (CHEBI:50176) |
| isotretinoin (CHEBI:6067) has role teratogenic agent (CHEBI:50905) |
| isotretinoin (CHEBI:6067) is a retinoic acid (CHEBI:26536) |
| isotretinoin (CHEBI:6067) is conjugate acid of 13-cis-retinoate (CHEBI:169952) |
| Incoming Relation(s) |
| 13-cis-retinoate (CHEBI:169952) is conjugate base of isotretinoin (CHEBI:6067) |
| IUPAC Name |
|---|
| (2Z,4E6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid |
| INNs | Source |
|---|---|
| isotretinoin | ChemIDplus |
| isotrétinoine | WHO MedNet |
| isotretinoinum | ChemIDplus |
| isotretinoína | WHO MedNet |
| Synonyms | Source |
|---|---|
| isotretinoino | ChemIDplus |
| 13-cis-retinoic acid | JCBN |
| (7E,9E,11E,13Z)-retinoic acid | JCBN |
| 13-RA | ChemIDplus |
| 13-cis-Vitamin A acid | ChemIDplus |
| Neovitamin A acid | ChemIDplus |
| Brand Names | Source |
|---|---|
| Accutane | DrugBank |
| Amnesteem | DrugBank |
| Claravis | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D00348 | KEGG DRUG |
| EP111325 | Patent |
| US4556518 | Patent |
| DB00982 | DrugBank |
| LMPR01090021 | LIPID MAPS |
| Isotretinoin | Wikipedia |
| HMDB0006219 | HMDB |
| 1508 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1885770 | Reaxys |
| CAS:4759-48-2 | ChemIDplus |
| Citations |
|---|