EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O5 |
| Net Charge | 0 |
| Average Mass | 354.487 |
| Monoisotopic Mass | 354.24062 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-17,19,21,23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | GMVPRGQOIOIIMI-DWKJAMRDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | anticoagulant An agent that prevents blood clotting. vasodilator agent A drug used to cause dilation of the blood vessels. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin E1 (CHEBI:15544) has role anticoagulant (CHEBI:50249) |
| prostaglandin E1 (CHEBI:15544) has role human metabolite (CHEBI:77746) |
| prostaglandin E1 (CHEBI:15544) has role platelet aggregation inhibitor (CHEBI:50427) |
| prostaglandin E1 (CHEBI:15544) has role vasodilator agent (CHEBI:35620) |
| prostaglandin E1 (CHEBI:15544) is a prostaglandins E (CHEBI:26338) |
| prostaglandin E1 (CHEBI:15544) is conjugate acid of prostaglandin E1(1−) (CHEBI:57397) |
| Incoming Relation(s) |
| 13,14-dihydro-15-oxoprostaglandin E1 (CHEBI:134499) has functional parent prostaglandin E1 (CHEBI:15544) |
| 15-dehydro-prostaglandin E1 (CHEBI:15548) has functional parent prostaglandin E1 (CHEBI:15544) |
| 20-hydroxyprostaglandin E1 (CHEBI:137526) has functional parent prostaglandin E1 (CHEBI:15544) |
| 6-oxoprostaglandin E1 (CHEBI:28269) has functional parent prostaglandin E1 (CHEBI:15544) |
| prostaglandin E1(1−) (CHEBI:57397) is conjugate base of prostaglandin E1 (CHEBI:15544) |
| IUPAC Name |
|---|
| (13E,15S)-11α,15-dihydroxy-9-oxoprost-13-en-1-oic acid |
| INNs | Source |
|---|---|
| alprostadil | WHO MedNet |
| alprostadil | KEGG DRUG |
| alprostadilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (11α,13E,15S)-11,15-dihydroxy-9-oxoprost-13-en-1-oic acid | ChemIDplus |
| 11α,15α-dihydroxy-9-oxo-13-trans-prostenoic acid | ChemIDplus |
| (13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprost-13-enoate | KEGG COMPOUND |
| (13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprost-13-enoate | KEGG COMPOUND |
| Alprostadil | KEGG COMPOUND |
| PGE-1 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Befar | KEGG DRUG |
| Caverject | DrugBank |
| Edex | DrugBank |
| Muse | DrugBank |
| Prostin VR | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 138 | DrugCentral |
| C04741 | KEGG COMPOUND |
| D00180 | KEGG DRUG |
| DB00770 | DrugBank |
| HMDB0001442 | HMDB |
| LMFA03010134 | LIPID MAPS |
| Prostaglandin_E1 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2061617 | Reaxys |
| CAS:745-65-3 | ChemIDplus |
| CAS:745-65-3 | KEGG COMPOUND |
| Citations |
|---|