EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O6 |
| Net Charge | 0 |
| Average Mass | 368.470 |
| Monoisotopic Mass | 368.21989 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C20H32O6/c1-2-3-4-7-14(21)10-11-16-17(19(24)13-18(16)23)12-15(22)8-5-6-9-20(25)26/h10-11,14,16-18,21,23H,2-9,12-13H2,1H3,(H,25,26)/b11-10+/t14-,16+,17+,18+/m0/s1 |
| InChIKey | ROUDCKODIMKLNO-CTBSXBMHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-oxoprostaglandin E1 (CHEBI:28269) has functional parent prostaglandin E1 (CHEBI:15544) |
| 6-oxoprostaglandin E1 (CHEBI:28269) has role metabolite (CHEBI:25212) |
| 6-oxoprostaglandin E1 (CHEBI:28269) has role platelet aggregation inhibitor (CHEBI:50427) |
| 6-oxoprostaglandin E1 (CHEBI:28269) is a prostaglandins E (CHEBI:26338) |
| 6-oxoprostaglandin E1 (CHEBI:28269) is conjugate acid of 6-oxoprostaglandin E1(1−) (CHEBI:134577) |
| Incoming Relation(s) |
| 6-oxoprostaglandin E1(1−) (CHEBI:134577) is conjugate base of 6-oxoprostaglandin E1 (CHEBI:28269) |
| IUPAC Name |
|---|
| (13E,15S)-11α,15-dihydroxy-6,9-dioxoprost-13-en-1-oic acid |
| Synonyms | Source |
|---|---|
| 6-Keto-prostaglandin E1 | KEGG COMPOUND |
| 6-Keto-PGE1 | KEGG COMPOUND |
| 6-Ketoprostaglandin E1 | ChemIDplus |
| 6-Oxo-PGE1 | ChemIDplus |
| 6-Oxoprostaglandin E1 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05962 | KEGG COMPOUND |
| LMFA03010012 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2904839 | Reaxys |
| CAS:67786-53-2 | ChemIDplus |
| CAS:67786-53-2 | KEGG COMPOUND |
| Citations |
|---|