EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O6 |
| Net Charge | 0 |
| Average Mass | 370.486 |
| Monoisotopic Mass | 370.23554 |
| SMILES | O=C(O)CCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)CCCCCO |
| InChI | InChI=1S/C20H34O6/c21-13-7-3-4-8-15(22)11-12-17-16(18(23)14-19(17)24)9-5-1-2-6-10-20(25)26/h11-12,15-17,19,21-22,24H,1-10,13-14H2,(H,25,26)/b12-11+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | LDUBDFDZFOQXGF-HTGUDJHRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ovis aries (ncbitaxon:9940) | - | PubMed (11370662) |
| Roles Classification |
|---|
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxyprostaglandin E1 (CHEBI:137526) has functional parent prostaglandin E1 (CHEBI:15544) |
| 20-hydroxyprostaglandin E1 (CHEBI:137526) has role mammalian metabolite (CHEBI:75768) |
| 20-hydroxyprostaglandin E1 (CHEBI:137526) is a primary alcohol (CHEBI:15734) |
| 20-hydroxyprostaglandin E1 (CHEBI:137526) is a prostaglandins E (CHEBI:26338) |
| 20-hydroxyprostaglandin E1 (CHEBI:137526) is a secondary allylic alcohol (CHEBI:134396) |
| 20-hydroxyprostaglandin E1 (CHEBI:137526) is a triol (CHEBI:27136) |
| 20-hydroxyprostaglandin E1 (CHEBI:137526) is conjugate acid of 20-hydroxyprostaglandin E1(1−) (CHEBI:136661) |
| Incoming Relation(s) |
| 20-hydroxyprostaglandin E1(1−) (CHEBI:136661) is conjugate base of 20-hydroxyprostaglandin E1 (CHEBI:137526) |
| IUPAC Name |
|---|
| (13E,15S)-11α,15,20-trihydroxy-9-oxoprost-13-en-1-oic acid |
| Synonyms | Source |
|---|---|
| (11α,13E,15S)-11,15,20-trihydroxy-9-oxoprost-13-en-1-oic acid | IUPAC |
| 20-hydroxy-PGE1 | ChEBI |
| 20-hydroxy prostaglandin E1 | ChEBI |
| 20-hydroxy-prostaglandin E1 | ChEBI |
| 20-OH-PGE1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2892253 | Reaxys |
| CAS:57930-99-1 | ChemIDplus |
| Citations |
|---|