EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O5 |
| Net Charge | -1 |
| Average Mass | 353.479 |
| Monoisotopic Mass | 353.23335 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)[O-] |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-17,19,21,23H,2-11,14H2,1H3,(H,24,25)/p-1/b13-12+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | GMVPRGQOIOIIMI-DWKJAMRDSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin E1(1−) (CHEBI:57397) has role human metabolite (CHEBI:77746) |
| prostaglandin E1(1−) (CHEBI:57397) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| prostaglandin E1(1−) (CHEBI:57397) is conjugate base of prostaglandin E1 (CHEBI:15544) |
| Incoming Relation(s) |
| 20-hydroxyprostaglandin E1(1−) (CHEBI:136661) has functional parent prostaglandin E1(1−) (CHEBI:57397) |
| prostaglandin E1 (CHEBI:15544) is conjugate acid of prostaglandin E1(1−) (CHEBI:57397) |
| IUPAC Name |
|---|
| (13E,15S)-11α,15-dihydroxy-9-oxoprost-13-en-1-oate |
| UniProt Name | Source |
|---|---|
| prostaglandin E1 | UniProt |