EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O5 |
| Net Charge | 0 |
| Average Mass | 354.487 |
| Monoisotopic Mass | 354.24062 |
| SMILES | CCCCCC(=O)CC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h16-17,19,23H,2-14H2,1H3,(H,24,25)/t16-,17-,19-/m1/s1 |
| InChIKey | CDUVSQMTLOYKTR-ZHALLVOQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (1589447) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,14-dihydro-15-oxoprostaglandin E1 (CHEBI:134499) has functional parent prostaglandin E1 (CHEBI:15544) |
| 13,14-dihydro-15-oxoprostaglandin E1 (CHEBI:134499) has role human xenobiotic metabolite (CHEBI:76967) |
| 13,14-dihydro-15-oxoprostaglandin E1 (CHEBI:134499) is a prostaglandins E (CHEBI:26338) |
| 13,14-dihydro-15-oxoprostaglandin E1 (CHEBI:134499) is conjugate acid of 13,14-dihydro-15-oxoprostaglandin E1(1−) (CHEBI:133408) |
| Incoming Relation(s) |
| 13,14-dihydro-15-oxoprostaglandin E1(1−) (CHEBI:133408) is conjugate base of 13,14-dihydro-15-oxoprostaglandin E1 (CHEBI:134499) |
| IUPAC Name |
|---|
| (11α)-11-hydroxy-9,15-dioxoprostan-1-oic acid |
| Synonyms | Source |
|---|---|
| 13,14-Dihydro-15-keto-PGE1 | ChemIDplus |
| 13,14-Dihydro-15-ketoprostaglandin E1 | ChemIDplus |
| 13,14-dihydro-15-oxo-PGE1 | ChEBI |
| 13,14-dihydro-15-oxo-prostaglandin E1 | ChEBI |
| 15-Keto-13,14-dihydro-PGE1 | ChemIDplus |
| U 21002 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3004655 | Reaxys |
| CAS:5094-14-4 | ChemIDplus |
| Citations |
|---|