EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N2O8 |
| Net Charge | 0 |
| Average Mass | 320.298 |
| Monoisotopic Mass | 320.12197 |
| SMILES | O=C(O)[C@@H](NCC[C@H](O)C(=O)O)[C@@H](O)CN1CC[C@H]1C(=O)O |
| InChI | InChI=1S/C12H20N2O8/c15-7(11(19)20)1-3-13-9(12(21)22)8(16)5-14-4-2-6(14)10(17)18/h6-9,13,15-16H,1-5H2,(H,17,18)(H,19,20)(H,21,22)/t6-,7-,8-,9-/m0/s1 |
| InChIKey | GJRGEVKCJPPZIT-JBDRJPRFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | phytosiderophore Any of low-molecular-mass iron(III)-chelating compounds produced by plants for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | phytosiderophore Any of low-molecular-mass iron(III)-chelating compounds produced by plants for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mugineic acid (CHEBI:25426) is a mugineic acids (CHEBI:25427) |
| mugineic acid (CHEBI:25426) is conjugate acid of mugineate(1−) (CHEBI:77826) |
| mugineic acid (CHEBI:25426) is conjugate acid of mugineate(2−) (CHEBI:58505) |
| Incoming Relation(s) |
| 2'-deoxymugineic acid (CHEBI:19274) has functional parent mugineic acid (CHEBI:25426) |
| 3-epi-3-hydroxy-2'-deoxymugineic acid (CHEBI:38159) has functional parent mugineic acid (CHEBI:25426) |
| 3-epi-3-hydroxymugineic acid (CHEBI:20013) has functional parent mugineic acid (CHEBI:25426) |
| 3-hydroxymugineic acid (CHEBI:38158) has functional parent mugineic acid (CHEBI:25426) |
| mugineate(1−) (CHEBI:77826) is conjugate base of mugineic acid (CHEBI:25426) |
| mugineate(2−) (CHEBI:58505) is conjugate base of mugineic acid (CHEBI:25426) |
| IUPAC Name |
|---|
| 4-[(2S)-2-carboxyazetidin-1-yl]-N-[(3S)-3-carboxy-3-hydroxypropyl]-L-allothreonine |
| Synonym | Source |
|---|---|
| N-(3-(3-Carboxypropylamino)-2-hydroxy-3-carboxypropyl)azetidine-2-carboxylic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C15500 | KEGG COMPOUND |
| KR20090078824 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5884020 | Reaxys |
| CAS:69199-37-7 | ChemIDplus |
| CAS:69199-37-7 | NIST Chemistry WebBook |
| CAS:69199-37-7 | KEGG COMPOUND |
| Citations |
|---|