EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O8 |
| Net Charge | -2 |
| Average Mass | 318.282 |
| Monoisotopic Mass | 318.10741 |
| SMILES | O=C([O-])[C@@H]([NH2+]CC[C@H](O)C(=O)[O-])[C@@H](O)CN1CC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C12H20N2O8/c15-7(11(19)20)1-3-13-9(12(21)22)8(16)5-14-4-2-6(14)10(17)18/h6-9,13,15-16H,1-5H2,(H,17,18)(H,19,20)(H,21,22)/p-2/t6-,7-,8-,9-/m0/s1 |
| InChIKey | GJRGEVKCJPPZIT-JBDRJPRFSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mugineate(2−) (CHEBI:58505) is a tricarboxylic acid anion (CHEBI:35753) |
| mugineate(2−) (CHEBI:58505) is conjugate base of mugineate(1−) (CHEBI:77826) |
| mugineate(2−) (CHEBI:58505) is conjugate base of mugineic acid (CHEBI:25426) |
| Incoming Relation(s) |
| mugineate(1−) (CHEBI:77826) is conjugate acid of mugineate(2−) (CHEBI:58505) |
| mugineic acid (CHEBI:25426) is conjugate acid of mugineate(2−) (CHEBI:58505) |
| IUPAC Name |
|---|
| (2S)-1-[(2S,3S)-3-carboxylato-3-{[(3S)-3-carboxylato-3-hydroxypropyl]ammonio}-2-hydroxypropyl]azetidine-2-carboxylate |