EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N2O7 |
| Net Charge | 0 |
| Average Mass | 304.299 |
| Monoisotopic Mass | 304.12705 |
| SMILES | O=C(O)[C@H](CCN1CC[C@H]1C(=O)O)NCC[C@H](O)C(=O)O |
| InChI | InChI=1S/C12H20N2O7/c15-9(12(20)21)1-4-13-7(10(16)17)2-5-14-6-3-8(14)11(18)19/h7-9,13,15H,1-6H2,(H,16,17)(H,18,19)(H,20,21)/t7-,8-,9-/m0/s1 |
| InChIKey | CUZKLRTTYZOCSD-CIUDSAMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-deoxymugineic acid (CHEBI:19274) has functional parent mugineic acid (CHEBI:25426) |
| 2'-deoxymugineic acid (CHEBI:19274) is a tricarboxylic acid (CHEBI:27093) |
| 2'-deoxymugineic acid (CHEBI:19274) is conjugate acid of 2'-deoxymugineate (CHEBI:58487) |
| Incoming Relation(s) |
| 2'-deoxymugineate (CHEBI:58487) is conjugate base of 2'-deoxymugineic acid (CHEBI:19274) |
| IUPAC Name |
|---|
| (2S)-1-[(3S)-3-carboxy-3-{[(3S)-3-carboxy-3-hydroxypropyl]amino}propyl]azetidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C15485 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5301911 | Beilstein |
| Beilstein:5301912 | Beilstein |
| CAS:74235-24-8 | ChemIDplus |
| CAS:74235-24-8 | KEGG COMPOUND |