EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N2O8 |
| Net Charge | 0 |
| Average Mass | 320.298 |
| Monoisotopic Mass | 320.12197 |
| SMILES | O=C(O)[C@H](CCN1C[C@H](O)[C@H]1C(=O)O)NCC[C@H](O)C(=O)O |
| InChI | InChI=1S/C12H20N2O8/c15-7(11(19)20)1-3-13-6(10(17)18)2-4-14-5-8(16)9(14)12(21)22/h6-9,13,15-16H,1-5H2,(H,17,18)(H,19,20)(H,21,22)/t6-,7-,8-,9-/m0/s1 |
| InChIKey | UQYFTKWTXJZWBK-JBDRJPRFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | phytosiderophore Any of low-molecular-mass iron(III)-chelating compounds produced by plants for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | phytosiderophore Any of low-molecular-mass iron(III)-chelating compounds produced by plants for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-epi-3-hydroxy-2'-deoxymugineic acid (CHEBI:38159) has functional parent mugineic acid (CHEBI:25426) |
| 3-epi-3-hydroxy-2'-deoxymugineic acid (CHEBI:38159) is a mugineic acids (CHEBI:25427) |
| 3-epi-3-hydroxy-2'-deoxymugineic acid (CHEBI:38159) is conjugate acid of 3-epi-3-hydroxy-2'-deoxymugineate (CHEBI:58684) |
| Incoming Relation(s) |
| 3-epi-3-hydroxy-2'-deoxymugineate (CHEBI:58684) is conjugate base of 3-epi-3-hydroxy-2'-deoxymugineic acid (CHEBI:38159) |
| IUPAC Name |
|---|
| (2S,3S)-1-[(3S)-3-carboxy-3-{[(3S)-3-carboxy-3-hydroxypropyl]amino}propyl]-3-hydroxyazetidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C15502 | KEGG COMPOUND |