EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N2O9 |
| Net Charge | 0 |
| Average Mass | 336.297 |
| Monoisotopic Mass | 336.11688 |
| SMILES | O=C(O)[C@@H](NCC[C@H](O)C(=O)O)[C@@H](O)CN1C[C@H](O)[C@H]1C(=O)O |
| InChI | InChI=1S/C12H20N2O9/c15-5(10(18)19)1-2-13-8(11(20)21)6(16)3-14-4-7(17)9(14)12(22)23/h5-9,13,15-17H,1-4H2,(H,18,19)(H,20,21)(H,22,23)/t5-,6-,7-,8-,9-/m0/s1 |
| InChIKey | QPIOQLJXMZWNFJ-LJASKYJCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-epi-3-hydroxymugineic acid (CHEBI:20013) has functional parent mugineic acid (CHEBI:25426) |
| 3-epi-3-hydroxymugineic acid (CHEBI:20013) is a tricarboxylic acid (CHEBI:27093) |
| 3-epi-3-hydroxymugineic acid (CHEBI:20013) is conjugate acid of 3-epi-3-hydroxymugineate(2−) (CHEBI:58488) |
| Incoming Relation(s) |
| 3-epi-3-hydroxymugineate(2−) (CHEBI:58488) is conjugate base of 3-epi-3-hydroxymugineic acid (CHEBI:20013) |
| IUPAC Name |
|---|
| 4-[(2S,3S)-2-carboxy-3-hydroxyazetidin-1-yl]-N-[(3S)-3-carboxy-3-hydroxypropyl]-L-allothreonine |
| Manual Xrefs | Databases |
|---|---|
| C15501 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5886036 | Beilstein |