EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O |
| Net Charge | 0 |
| Average Mass | 156.269 |
| Monoisotopic Mass | 156.15142 |
| SMILES | CC1CCC(C(C)C)C(O)C1 |
| InChI | InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3 |
| InChIKey | NOOLISFMXDJSKH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-menthan-3-ol (CHEBI:25187) has role volatile oil component (CHEBI:27311) |
| p-menthan-3-ol (CHEBI:25187) is a p-menthane monoterpenoid (CHEBI:25186) |
| p-menthan-3-ol (CHEBI:25187) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| (+)-menthol (CHEBI:76306) is a p-menthan-3-ol (CHEBI:25187) |
| (+)-neomenthol (CHEBI:15402) is a p-menthan-3-ol (CHEBI:25187) |
| (−)-menthol (CHEBI:15409) is a p-menthan-3-ol (CHEBI:25187) |
| neoisomenthol (CHEBI:18451) is a p-menthan-3-ol (CHEBI:25187) |