EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O |
| Net Charge | 0 |
| Average Mass | 156.269 |
| Monoisotopic Mass | 156.15142 |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | NOOLISFMXDJSKH-KXUCPTDWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-menthol (CHEBI:15409) has role antipruritic drug (CHEBI:59683) |
| (−)-menthol (CHEBI:15409) has role antispasmodic drug (CHEBI:53784) |
| (−)-menthol (CHEBI:15409) has role antitussive (CHEBI:51177) |
| (−)-menthol (CHEBI:15409) is a p-menthan-3-ol (CHEBI:25187) |
| (−)-menthol (CHEBI:15409) is enantiomer of (+)-menthol (CHEBI:76306) |
| Incoming Relation(s) |
| (−)-menthyl β-D-glucoside (CHEBI:15411) has functional parent (−)-menthol (CHEBI:15409) |
| 4-formyl-2-methoxyphenyl L-menthyl glutarate (CHEBI:195230) has functional parent (−)-menthol (CHEBI:15409) |
| (±)-menthol (CHEBI:76310) has part (−)-menthol (CHEBI:15409) |
| (+)-menthol (CHEBI:76306) is enantiomer of (−)-menthol (CHEBI:15409) |
| IUPAC Name |
|---|
| (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexan-1-ol |
| INNs | Source |
|---|---|
| levomenthol | ChemIDplus |
| lévomenthol | WHO MedNet |
| levomentholum | WHO MedNet |
| levomentol | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1alpha,2beta,5alpha)-5-methyl-2(1-methylethyl)cyclohexanol | ChEBI |
| (1R-(1-α,2-β,5-α))-5-methyl-2-(1-methylethyl)cyclohexanol | ChemIDplus |
| (−)-(1R,3R,4S)-menthol | ChemIDplus |
| (1R,3R,4S)-(−)-menthol | NIST Chemistry WebBook |
| l-menthol | ChEBI |
| L-Menthol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (−)-menthol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 934 | DrugCentral |
| C00000810 | KNApSAcK |
| C00400 | KEGG COMPOUND |
| CN101602651 | Patent |
| D00064 | KEGG DRUG |
| DB00825 | DrugBank |
| HMDB0003352 | HMDB |
| LMPR0102090001 | LIPID MAPS |
| Menthol | Wikipedia |
| --MENTHOL | MetaCyc |
| US2011313205 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1902293 | Reaxys |
| CAS:2216-51-5 | KEGG COMPOUND |
| CAS:2216-51-5 | NIST Chemistry WebBook |
| Citations |
|---|